C28H45NO6 — CID 162937318
[(1R,2R,3R,4R,5R,6S,8S,9R,10S,13R,16S,17S)-8-ethoxy-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] acetate (PubChem CID 162937318) has the molecular formula C28H45NO6 and a molecular weight of 491.67 g/mol. Its IUPAC name is [(1R,2R,3R,4R,5R,6S,8S,9R,10S,13R,16S,17S)-8-ethoxy-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] acetate.
| Compound Name | [(1R,2R,3R,4R,5R,6S,8S,9R,10S,13R,16S,17S)-8-ethoxy-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] acetate |
|---|---|
| PubChem CID | 162937318 |
| Molecular Formula | C28H45NO6 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | [(1R,2R,3R,4R,5R,6S,8S,9R,10S,13R,16S,17S)-8-ethoxy-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] acetate |
| SMILES | CCO[C@]12C[C@H](OC)[C@H]3C[C@H]([C@@H]1[C@@H]3OC(C)=O)[C@]13[C@@H](OC)CC[C@]4(COC)CN(CC)[C@H]1[C@H]2C[C@@H]43 |
| InChI | InChI=1S/C28H45NO6/c1-7-29-14-26(15-31-4)10-9-22(33-6)28-18-11-17-20(32-5)13-27(34-8-2,19(25(28)29)12-21(26)28)23(18)24(17)35-16(3)30/h17-25H,7-15H2,1-6H3/t17-,18-,19-,20+,21+,22+,23-,24-,25+,26-,27+,28+/m1/s1 |
| InChIKey | MBNBAHNWJUHSQR-DQHXSLDSSA-N |
| XLogP | 3.15 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |