C21H21ClF3N5O3S — CID 140603283
N-[3-[[6-(4-chloroanilino)pyrimidin-4-yl]amino]-1,1,1-trifluoro-2-methylbutan-2-yl]oxybenzenesulfonamide (PubChem CID 140603283) has the molecular formula C21H21ClF3N5O3S and a molecular weight of 515.95 g/mol. Its IUPAC name is N-[3-[[6-(4-chloroanilino)pyrimidin-4-yl]amino]-1,1,1-trifluoro-2-methylbutan-2-yl]oxybenzenesulfonamide.
| Compound Name | N-[3-[[6-(4-chloroanilino)pyrimidin-4-yl]amino]-1,1,1-trifluoro-2-methylbutan-2-yl]oxybenzenesulfonamide |
|---|---|
| PubChem CID | 140603283 |
| Molecular Formula | C21H21ClF3N5O3S |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | N-[3-[[6-(4-chloroanilino)pyrimidin-4-yl]amino]-1,1,1-trifluoro-2-methylbutan-2-yl]oxybenzenesulfonamide |
| SMILES | CC(Nc1cc(Nc2ccc(Cl)cc2)ncn1)C(C)(ONS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H21ClF3N5O3S/c1-14(28-18-12-19(27-13-26-18)29-16-10-8-15(22)9-11-16)20(2,21(23,24)25)33-30-34(31,32)17-6-4-3-5-7-17/h3-14,30H,1-2H3,(H2,26,27,28,29) |
| InChIKey | INWQBGKXCRVJIH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|