C20H17ClF3N5O6S2 — CID 123367595
[[3-[[[6-(4-chloroanilino)pyrimidin-4-yl]amino]methyl]-4-methylsulfonylphenyl]sulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 123367595) has the molecular formula C20H17ClF3N5O6S2 and a molecular weight of 579.97 g/mol. Its IUPAC name is [[3-[[[6-(4-chloroanilino)pyrimidin-4-yl]amino]methyl]-4-methylsulfonylphenyl]sulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[[[6-(4-chloroanilino)pyrimidin-4-yl]amino]methyl]-4-methylsulfonylphenyl]sulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 123367595 |
| Molecular Formula | C20H17ClF3N5O6S2 |
| Molecular Weight | 579.97 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | [[3-[[[6-(4-chloroanilino)pyrimidin-4-yl]amino]methyl]-4-methylsulfonylphenyl]sulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NOC(=O)C(F)(F)F)cc1CNc1cc(Nc2ccc(Cl)cc2)ncn1 |
| InChI | InChI=1S/C20H17ClF3N5O6S2/c1-36(31,32)16-7-6-15(37(33,34)29-35-19(30)20(22,23)24)8-12(16)10-25-17-9-18(27-11-26-17)28-14-4-2-13(21)3-5-14/h2-9,11,29H,10H2,1H3,(H2,25,26,27,28) |
| InChIKey | HDFVGPZPXLXILZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|