C23H24F3N5O4S — CID 89306614
[[3-[[6-(4-tert-butylanilino)pyrimidin-4-yl]amino]phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate (PubChem CID 89306614) has the molecular formula C23H24F3N5O4S and a molecular weight of 523.54 g/mol. Its IUPAC name is [[3-[[6-(4-tert-butylanilino)pyrimidin-4-yl]amino]phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[[6-(4-tert-butylanilino)pyrimidin-4-yl]amino]phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89306614 |
| Molecular Formula | C23H24F3N5O4S |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [[3-[[6-(4-tert-butylanilino)pyrimidin-4-yl]amino]phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
| SMILES | CN(OC(=O)C(F)(F)F)S(=O)(=O)c1cccc(Nc2cc(Nc3ccc(C(C)(C)C)cc3)ncn2)c1 |
| InChI | InChI=1S/C23H24F3N5O4S/c1-22(2,3)15-8-10-16(11-9-15)29-19-13-20(28-14-27-19)30-17-6-5-7-18(12-17)36(33,34)31(4)35-21(32)23(24,25)26/h5-14H,1-4H3,(H2,27,28,29,30) |
| InChIKey | YCYATDVHFAOOOQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|