C21H19BrF3N5O5S — CID 89306790
[[3-[[6-(3-bromo-5-methylanilino)pyrimidin-4-yl]amino]-4-methoxyphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate (PubChem CID 89306790) has the molecular formula C21H19BrF3N5O5S and a molecular weight of 590.38 g/mol. Its IUPAC name is [[3-[[6-(3-bromo-5-methylanilino)pyrimidin-4-yl]amino]-4-methoxyphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[[6-(3-bromo-5-methylanilino)pyrimidin-4-yl]amino]-4-methoxyphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89306790 |
| Molecular Formula | C21H19BrF3N5O5S |
| Molecular Weight | 590.38 g/mol |
| Exact Mass | 589.02 |
| IUPAC Name | [[3-[[6-(3-bromo-5-methylanilino)pyrimidin-4-yl]amino]-4-methoxyphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(S(=O)(=O)N(C)OC(=O)C(F)(F)F)cc1Nc1cc(Nc2cc(C)cc(Br)c2)ncn1 |
| InChI | InChI=1S/C21H19BrF3N5O5S/c1-12-6-13(22)8-14(7-12)28-18-10-19(27-11-26-18)29-16-9-15(4-5-17(16)34-3)36(32,33)30(2)35-20(31)21(23,24)25/h4-11H,1-3H3,(H2,26,27,28,29) |
| InChIKey | FJYVFGHTIDIJFX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|