C22H19F3N6O4S2 — CID 89306231
[[3-[[6-(1H-indol-5-ylamino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate (PubChem CID 89306231) has the molecular formula C22H19F3N6O4S2 and a molecular weight of 552.56 g/mol. Its IUPAC name is [[3-[[6-(1H-indol-5-ylamino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[[6-(1H-indol-5-ylamino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89306231 |
| Molecular Formula | C22H19F3N6O4S2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | [[3-[[6-(1H-indol-5-ylamino)pyrimidin-4-yl]amino]-4-methylsulfanylphenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
| SMILES | CSc1ccc(S(=O)(=O)N(C)OC(=O)C(F)(F)F)cc1Nc1cc(Nc2ccc3[nH]ccc3c2)ncn1 |
| InChI | InChI=1S/C22H19F3N6O4S2/c1-31(35-21(32)22(23,24)25)37(33,34)15-4-6-18(36-2)17(10-15)30-20-11-19(27-12-28-20)29-14-3-5-16-13(9-14)7-8-26-16/h3-12,26H,1-2H3,(H2,27,28,29,30) |
| InChIKey | PCDYDYAMSVCSGG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|