C21H17BrF6N6O5S — CID 89306940
[[3-[[6-[(6-bromo-4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate (PubChem CID 89306940) has the molecular formula C21H17BrF6N6O5S and a molecular weight of 659.36 g/mol. Its IUPAC name is [[3-[[6-[(6-bromo-4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[[6-[(6-bromo-4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89306940 |
| Molecular Formula | C21H17BrF6N6O5S |
| Molecular Weight | 659.36 g/mol |
| Exact Mass | 658.01 |
| IUPAC Name | [[3-[[6-[(6-bromo-4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]-4-(2,2,2-trifluoroethoxy)phenyl]sulfonyl-methylamino] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(Br)nc(Nc2cc(Nc3cc(S(=O)(=O)N(C)OC(=O)C(F)(F)F)ccc3OCC(F)(F)F)ncn2)c1 |
| InChI | InChI=1S/C21H17BrF6N6O5S/c1-11-5-15(22)32-18(6-11)33-17-8-16(29-10-30-17)31-13-7-12(3-4-14(13)38-9-20(23,24)25)40(36,37)34(2)39-19(35)21(26,27)28/h3-8,10H,9H2,1-2H3,(H2,29,30,31,32,33) |
| InChIKey | PADWMFACNYYUGJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|