C23H19F3N6O4S2 — CID 89306612
[methyl-[3-[[6-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 89306612) has the molecular formula C23H19F3N6O4S2 and a molecular weight of 564.57 g/mol. Its IUPAC name is [methyl-[3-[[6-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [methyl-[3-[[6-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89306612 |
| Molecular Formula | C23H19F3N6O4S2 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | [methyl-[3-[[6-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]phenyl]sulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | Cc1nc(-c2cccc(Nc3cc(Nc4cccc(S(=O)(=O)N(C)OC(=O)C(F)(F)F)c4)ncn3)c2)cs1 |
| InChI | InChI=1S/C23H19F3N6O4S2/c1-14-29-19(12-37-14)15-5-3-6-16(9-15)30-20-11-21(28-13-27-20)31-17-7-4-8-18(10-17)38(34,35)32(2)36-22(33)23(24,25)26/h3-13H,1-2H3,(H2,27,28,30,31) |
| InChIKey | UKWIOHPWLGLQKJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|