C20H19BrF3N5O3S — CID 162043465
4-N-(6-bromo-4-methyl-2-pyridinyl)-6-N-[5-ethylsulfonyl-2-(2,2,2-trifluoroethoxy)phenyl]pyrimidine-4,6-diamine (PubChem CID 162043465) has the molecular formula C20H19BrF3N5O3S and a molecular weight of 546.37 g/mol. Its IUPAC name is 4-N-(6-bromo-4-methyl-2-pyridinyl)-6-N-[5-ethylsulfonyl-2-(2,2,2-trifluoroethoxy)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(6-bromo-4-methyl-2-pyridinyl)-6-N-[5-ethylsulfonyl-2-(2,2,2-trifluoroethoxy)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 162043465 |
| Molecular Formula | C20H19BrF3N5O3S |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.03 |
| IUPAC Name | 4-N-(6-bromo-4-methyl-2-pyridinyl)-6-N-[5-ethylsulfonyl-2-(2,2,2-trifluoroethoxy)phenyl]pyrimidine-4,6-diamine |
| SMILES | CCS(=O)(=O)c1ccc(OCC(F)(F)F)c(Nc2cc(Nc3cc(C)cc(Br)n3)ncn2)c1 |
| InChI | InChI=1S/C20H19BrF3N5O3S/c1-3-33(30,31)13-4-5-15(32-10-20(22,23)24)14(8-13)27-17-9-18(26-11-25-17)29-19-7-12(2)6-16(21)28-19/h4-9,11H,3,10H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | YXOWLLRHCICVGH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|