About 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium)
1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) (PubChem CID 140607349) has the molecular formula C10H8N2Pd2
and a molecular weight of 369.03 g/mol. Its IUPAC name is 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium).
Molecular Properties
| Compound Name | 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) |
| PubChem CID | 140607349 |
| Molecular Formula | C10H8N2Pd2 |
| Molecular Weight | 369.03 g/mol |
| Exact Mass | 367.88 |
| IUPAC Name | 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) |
| SMILES | [C-]#[N+]c1ccccc1C(C)[N+]#[C-].[Pd].[Pd] |
| InChI | InChI=1S/C10H8N2.2Pd/c1-8(11-2)9-6-4-5-7-10(9)12-3;;/h4-8H,1H3;; |
| InChIKey | QIUGNUXSOMDFOU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.03 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium)?
The IUPAC name of 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) (CID 140607349) is 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium).
What is the SMILES notation for 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium)?
The canonical SMILES for 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) is [C-]#[N+]c1ccccc1C(C)[N+]#[C-].[Pd].[Pd].
What is the InChIKey of 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium)?
The InChIKey is QIUGNUXSOMDFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2Pd/c1-8(11-2)9-6-4-5-7-10(9)12-3;;/h4-8H,1H3;;.
What are the key properties of 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium)?
1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) has a molecular weight of 369.03 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyano-2-(1-isocyanoethyl)benzene;bis(palladium) is sourced from PubChem (CID 140607349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).