C30H31IrN2O2- — CID 140608905
3,5-diphenyl-2-phenylpyrazine;2-(1-hydroxyethyl)cyclohexan-1-ol;iridium (PubChem CID 140608905) has the molecular formula C30H31IrN2O2- and a molecular weight of 643.81 g/mol. Its IUPAC name is 3,5-diphenyl-2-phenylpyrazine;2-(1-hydroxyethyl)cyclohexan-1-ol;iridium.
| Compound Name | 3,5-diphenyl-2-phenylpyrazine;2-(1-hydroxyethyl)cyclohexan-1-ol;iridium |
|---|---|
| PubChem CID | 140608905 |
| Molecular Formula | C30H31IrN2O2- |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | 3,5-diphenyl-2-phenylpyrazine;2-(1-hydroxyethyl)cyclohexan-1-ol;iridium |
| SMILES | CC(O)C1CCCCC1O.[Ir].[c-]1ccccc1-c1ncc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H15N2.C8H16O2.Ir/c1-4-10-17(11-5-1)20-16-23-21(18-12-6-2-7-13-18)22(24-20)19-14-8-3-9-15-19;1-6(9)7-4-2-3-5-8(7)10;/h1-12,14-16H;6-10H,2-5H2,1H3;/q-1;; |
| InChIKey | XIBJHXMDCSEYNG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|