C27H27IrN2O4- — CID 58991397
1,3-dimethoxypropane-1,3-diol;3,5-diphenyl-2-phenylpyrazine;iridium (PubChem CID 58991397) has the molecular formula C27H27IrN2O4- and a molecular weight of 635.74 g/mol. Its IUPAC name is 1,3-dimethoxypropane-1,3-diol;3,5-diphenyl-2-phenylpyrazine;iridium.
| Compound Name | 1,3-dimethoxypropane-1,3-diol;3,5-diphenyl-2-phenylpyrazine;iridium |
|---|---|
| PubChem CID | 58991397 |
| Molecular Formula | C27H27IrN2O4- |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 1,3-dimethoxypropane-1,3-diol;3,5-diphenyl-2-phenylpyrazine;iridium |
| SMILES | COC(O)CC(O)OC.[Ir].[c-]1ccccc1-c1ncc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H15N2.C5H12O4.Ir/c1-4-10-17(11-5-1)20-16-23-21(18-12-6-2-7-13-18)22(24-20)19-14-8-3-9-15-19;1-8-4(6)3-5(7)9-2;/h1-12,14-16H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | BDMLBWJPLFKWBX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|