C12H19NO4 — CID 140609861
(3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione (PubChem CID 140609861) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 140609861 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (3R)-1-[(1R,2R)-2-ethoxycyclohexyl]-3-hydroxypyrrolidine-2,5-dione |
| SMILES | CCO[C@@H]1CCCC[C@H]1N1C(=O)C[C@@H](O)C1=O |
| InChI | InChI=1S/C12H19NO4/c1-2-17-10-6-4-3-5-8(10)13-11(15)7-9(14)12(13)16/h8-10,14H,2-7H2,1H3/t8-,9-,10-/m1/s1 |
| InChIKey | YAXFJKWGLJWJBC-OPRDCNLKSA-N |
| XLogP | 0.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|