C18H34O2Si — CID 140609929
(2R,3E,3aS,7S)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol (PubChem CID 140609929) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (2R,3E,3aS,7S)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol.
| Compound Name | (2R,3E,3aS,7S)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 140609929 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (2R,3E,3aS,7S)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol |
| SMILES | C/C=C1/[C@H](O)CC2[C@@H](O[Si](CC)(CC)CC)CCC[C@]12C |
| InChI | InChI=1S/C18H34O2Si/c1-6-14-16(19)13-15-17(11-10-12-18(14,15)5)20-21(7-2,8-3)9-4/h6,15-17,19H,7-13H2,1-5H3/b14-6-/t15?,16-,17+,18-/m1/s1 |
| InChIKey | BLYAKMYLWAGVQM-BECPCEOLSA-N |
| XLogP | 4.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|