C25H48O3SSi — CID 140609933
[(4S,7aS)-1-[(2R)-5-tert-butylsulfonylpentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane (PubChem CID 140609933) has the molecular formula C25H48O3SSi and a molecular weight of 456.81 g/mol. Its IUPAC name is [(4S,7aS)-1-[(2R)-5-tert-butylsulfonylpentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(4S,7aS)-1-[(2R)-5-tert-butylsulfonylpentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 140609933 |
| Molecular Formula | C25H48O3SSi |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | [(4S,7aS)-1-[(2R)-5-tert-butylsulfonylpentan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CCCS(=O)(=O)C(C)(C)C)=CCC12 |
| InChI | InChI=1S/C25H48O3SSi/c1-9-30(10-2,11-3)28-23-15-12-18-25(8)21(16-17-22(23)25)20(4)14-13-19-29(26,27)24(5,6)7/h16,20,22-23H,9-15,17-19H2,1-8H3/t20-,22?,23+,25-/m1/s1 |
| InChIKey | TVUVXBRNRHWTOD-NNEGKFNASA-N |
| XLogP | 7.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|