C18H29FO3S — CID 142019797
(3aS,7S,7aR)-3-[(Z,2R)-5-ethylsulfonyl-5-fluoropent-4-en-2-yl]-7-methoxy-3a-methyl-1,4,5,6,7,7a-hexahydroindene (PubChem CID 142019797) has the molecular formula C18H29FO3S and a molecular weight of 344.49 g/mol. Its IUPAC name is (3aS,7S,7aR)-3-[(Z,2R)-5-ethylsulfonyl-5-fluoropent-4-en-2-yl]-7-methoxy-3a-methyl-1,4,5,6,7,7a-hexahydroindene.
| Compound Name | (3aS,7S,7aR)-3-[(Z,2R)-5-ethylsulfonyl-5-fluoropent-4-en-2-yl]-7-methoxy-3a-methyl-1,4,5,6,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 142019797 |
| Molecular Formula | C18H29FO3S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3aS,7S,7aR)-3-[(Z,2R)-5-ethylsulfonyl-5-fluoropent-4-en-2-yl]-7-methoxy-3a-methyl-1,4,5,6,7,7a-hexahydroindene |
| SMILES | CCS(=O)(=O)/C(F)=C\C[C@@H](C)C1=CC[C@H]2[C@@H](OC)CCC[C@]12C |
| InChI | InChI=1S/C18H29FO3S/c1-5-23(20,21)17(19)11-8-13(2)14-9-10-15-16(22-4)7-6-12-18(14,15)3/h9,11,13,15-16H,5-8,10,12H2,1-4H3/b17-11-/t13-,15+,16+,18-/m1/s1 |
| InChIKey | HPWWPZOQMKLPSK-WBVYUHCWSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|