C19H32O3S — CID 10807122
(3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 10807122) has the molecular formula C19H32O3S and a molecular weight of 340.53 g/mol. Its IUPAC name is (3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 10807122 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](C/C=C/S(=O)(=O)C(C)(C)C)C1=CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C19H32O3S/c1-14(8-7-13-23(21,22)18(2,3)4)15-10-11-16-17(20)9-6-12-19(15,16)5/h7,10,13-14,16-17,20H,6,8-9,11-12H2,1-5H3/b13-7+/t14-,16+,17+,19-/m1/s1 |
| InChIKey | MFESSLGHVNFHIA-CLYSJAFYSA-N |
| XLogP | 4.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|