C19H22INO3 — CID 140610626
[(1S)-1-hydroxy-1-(2-iodophenyl)-3-methylbutyl] N-benzylcarbamate (PubChem CID 140610626) has the molecular formula C19H22INO3 and a molecular weight of 439.29 g/mol. Its IUPAC name is [(1S)-1-hydroxy-1-(2-iodophenyl)-3-methylbutyl] N-benzylcarbamate.
| Compound Name | [(1S)-1-hydroxy-1-(2-iodophenyl)-3-methylbutyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 140610626 |
| Molecular Formula | C19H22INO3 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | [(1S)-1-hydroxy-1-(2-iodophenyl)-3-methylbutyl] N-benzylcarbamate |
| SMILES | CC(C)C[C@](O)(OC(=O)NCc1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C19H22INO3/c1-14(2)12-19(23,16-10-6-7-11-17(16)20)24-18(22)21-13-15-8-4-3-5-9-15/h3-11,14,23H,12-13H2,1-2H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | HVEWGSDWYGMJQE-IBGZPJMESA-N |
| XLogP | 4.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|