C16H14ClN4OSY- — CID 140612179
6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridine-2-thiolate;yttrium (PubChem CID 140612179) has the molecular formula C16H14ClN4OSY- and a molecular weight of 434.74 g/mol. Its IUPAC name is 6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridine-2-thiolate;yttrium.
| Compound Name | 6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridine-2-thiolate;yttrium |
|---|---|
| PubChem CID | 140612179 |
| Molecular Formula | C16H14ClN4OSY- |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | 6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridine-2-thiolate;yttrium |
| SMILES | [S-]c1nc2nc(-c3ccc(N4CCOCC4)cc3)c(Cl)cc2[nH]1.[Y] |
| InChI | InChI=1S/C16H15ClN4OS.Y/c17-12-9-13-15(20-16(23)18-13)19-14(12)10-1-3-11(4-2-10)21-5-7-22-8-6-21;/h1-4,9H,5-8H2,(H2,18,19,20,23);/p-1 |
| InChIKey | KMBFGZKCWMLOLB-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|