C19H21ClN4O — CID 90160442
6-chloro-2-ethoxy-5-(4-piperidin-1-ylphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 90160442) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is 6-chloro-2-ethoxy-5-(4-piperidin-1-ylphenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-chloro-2-ethoxy-5-(4-piperidin-1-ylphenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 90160442 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6-chloro-2-ethoxy-5-(4-piperidin-1-ylphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CCOc1nc2nc(-c3ccc(N4CCCCC4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H21ClN4O/c1-2-25-19-21-16-12-15(20)17(22-18(16)23-19)13-6-8-14(9-7-13)24-10-4-3-5-11-24/h6-9,12H,2-5,10-11H2,1H3,(H,21,22,23) |
| InChIKey | FAKAJEGSHTUDSK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |