C25H31ClN4O4 — CID 144512156
2-[3-[[6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclobutyl]-2-methylpropanal;methanol (PubChem CID 144512156) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is 2-[3-[[6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclobutyl]-2-methylpropanal;methanol.
| Compound Name | 2-[3-[[6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclobutyl]-2-methylpropanal;methanol |
|---|---|
| PubChem CID | 144512156 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[3-[[6-chloro-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-2-yl]oxy]cyclobutyl]-2-methylpropanal;methanol |
| SMILES | CC(C)(C=O)C1CC(Oc2nc3nc(-c4ccc(N5CCOCC5)cc4)c(Cl)cc3[nH]2)C1.CO |
| InChI | InChI=1S/C24H27ClN4O3.CH4O/c1-24(2,14-30)16-11-18(12-16)32-23-26-20-13-19(25)21(27-22(20)28-23)15-3-5-17(6-4-15)29-7-9-31-10-8-29;1-2/h3-6,13-14,16,18H,7-12H2,1-2H3,(H,26,27,28);2H,1H3 |
| InChIKey | ZJOYPOUSMWJZMQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|