C36H43N3O8 — CID 140613020
tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]anilino]-4-oxobutanoate (PubChem CID 140613020) has the molecular formula C36H43N3O8 and a molecular weight of 645.75 g/mol. Its IUPAC name is tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]anilino]-4-oxobutanoate.
| Compound Name | tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 140613020 |
| Molecular Formula | C36H43N3O8 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | tert-butyl 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]anilino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(OCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C36H43N3O8/c1-35(2,3)46-31(40)21-30(32(41)38-23-15-17-24(18-16-23)44-20-19-37-33(42)47-36(4,5)6)39-34(43)45-22-29-27-13-9-7-11-25(27)26-12-8-10-14-28(26)29/h7-18,29-30H,19-22H2,1-6H3,(H,37,42)(H,38,41)(H,39,43) |
| InChIKey | RXKLPHCLXIIIGR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|