C20H16N2O2 — CID 140616487
N-acetyl-N-[4-[4-(4-aminophenyl)buta-1,3-diynyl]phenyl]acetamide (PubChem CID 140616487) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-acetyl-N-[4-[4-(4-aminophenyl)buta-1,3-diynyl]phenyl]acetamide.
| Compound Name | N-acetyl-N-[4-[4-(4-aminophenyl)buta-1,3-diynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 140616487 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-acetyl-N-[4-[4-(4-aminophenyl)buta-1,3-diynyl]phenyl]acetamide |
| SMILES | CC(=O)N(C(C)=O)c1ccc(C#CC#Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C20H16N2O2/c1-15(23)22(16(2)24)20-13-9-18(10-14-20)6-4-3-5-17-7-11-19(21)12-8-17/h7-14H,21H2,1-2H3 |
| InChIKey | VVKTYECFLTZJTK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|