C37H34BN3O2 — CID 140616712
3-pyridin-4-yl-5-(4,4,5,5-tetramethyldioxaborolan-3-yl)-1-tritylindazole (PubChem CID 140616712) has the molecular formula C37H34BN3O2 and a molecular weight of 563.51 g/mol. Its IUPAC name is 3-pyridin-4-yl-5-(4,4,5,5-tetramethyldioxaborolan-3-yl)-1-tritylindazole.
| Compound Name | 3-pyridin-4-yl-5-(4,4,5,5-tetramethyldioxaborolan-3-yl)-1-tritylindazole |
|---|---|
| PubChem CID | 140616712 |
| Molecular Formula | C37H34BN3O2 |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 3-pyridin-4-yl-5-(4,4,5,5-tetramethyldioxaborolan-3-yl)-1-tritylindazole |
| SMILES | CC1(C)OOB(c2ccc3c(c2)c(-c2ccncc2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C37H34BN3O2/c1-35(2)36(3,4)42-43-38(35)31-20-21-33-32(26-31)34(27-22-24-39-25-23-27)40-41(33)37(28-14-8-5-9-15-28,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-26H,1-4H3 |
| InChIKey | NVRMPAFJJZPYCN-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|