C26H16N8PtS6 — CID 140616809
bis(1,3-dipyridin-3-yl-2-sulfanylideneimidazole-4,5-dithiolate);platinum(4+) (PubChem CID 140616809) has the molecular formula C26H16N8PtS6 and a molecular weight of 827.95 g/mol. Its IUPAC name is bis(1,3-dipyridin-3-yl-2-sulfanylideneimidazole-4,5-dithiolate);platinum(4+).
| Compound Name | bis(1,3-dipyridin-3-yl-2-sulfanylideneimidazole-4,5-dithiolate);platinum(4+) |
|---|---|
| PubChem CID | 140616809 |
| Molecular Formula | C26H16N8PtS6 |
| Molecular Weight | 827.95 g/mol |
| Exact Mass | 826.95 |
| IUPAC Name | bis(1,3-dipyridin-3-yl-2-sulfanylideneimidazole-4,5-dithiolate);platinum(4+) |
| SMILES | S=c1n(-c2cccnc2)c([S-])c([S-])n1-c1cccnc1.S=c1n(-c2cccnc2)c([S-])c([S-])n1-c1cccnc1.[Pt+4] |
| InChI | InChI=1S/2C13H10N4S3.Pt/c2*18-11-12(19)17(10-4-2-6-15-8-10)13(20)16(11)9-3-1-5-14-7-9;/h2*1-8,18-19H;/q;;+4/p-4 |
| InChIKey | JYFSLRYXDYVZJP-UHFFFAOYSA-J |
| XLogP | 5.20 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.95 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|