C28H22N9O2S4+ — CID 162441284
ethane;4,4',6,6'-tetrapyridin-3-yl-2,2'-spirobi[imidazo[4,5-d][1,3,2]dithiazol-2-ium]-5,5'-dione (PubChem CID 162441284) has the molecular formula C28H22N9O2S4+ and a molecular weight of 644.81 g/mol. Its IUPAC name is ethane;4,4',6,6'-tetrapyridin-3-yl-2,2'-spirobi[imidazo[4,5-d][1,3,2]dithiazol-2-ium]-5,5'-dione.
| Compound Name | ethane;4,4',6,6'-tetrapyridin-3-yl-2,2'-spirobi[imidazo[4,5-d][1,3,2]dithiazol-2-ium]-5,5'-dione |
|---|---|
| PubChem CID | 162441284 |
| Molecular Formula | C28H22N9O2S4+ |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.08 |
| IUPAC Name | ethane;4,4',6,6'-tetrapyridin-3-yl-2,2'-spirobi[imidazo[4,5-d][1,3,2]dithiazol-2-ium]-5,5'-dione |
| SMILES | CC.O=c1n(-c2cccnc2)c2c(n1-c1cccnc1)S[N+]1(S2)Sc2c(n(-c3cccnc3)c(=O)n2-c2cccnc2)S1 |
| InChI | InChI=1S/C26H16N9O2S4.C2H6/c36-25-31(17-5-1-9-27-13-17)21-22(32(25)18-6-2-10-28-14-18)39-35(38-21)40-23-24(41-35)34(20-8-4-12-30-16-20)26(37)33(23)19-7-3-11-29-15-19;1-2/h1-16H;1-2H3/q+1; |
| InChIKey | OMURWJGIKMYLKV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 105.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|