C15H11NO2S — CID 140618878
(2Z)-5-imino-2-[(5-phenylfuran-2-yl)methylidene]thiolan-3-one (PubChem CID 140618878) has the molecular formula C15H11NO2S and a molecular weight of 269.32 g/mol. Its IUPAC name is (2Z)-5-imino-2-[(5-phenylfuran-2-yl)methylidene]thiolan-3-one.
| Compound Name | (2Z)-5-imino-2-[(5-phenylfuran-2-yl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 140618878 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (2Z)-5-imino-2-[(5-phenylfuran-2-yl)methylidene]thiolan-3-one |
| SMILES | [H]/N=C1\CC(=O)/C(=C/c2ccc(-c3ccccc3)o2)S1 |
| InChI | InChI=1S/C15H11NO2S/c16-15-9-12(17)14(19-15)8-11-6-7-13(18-11)10-4-2-1-3-5-10/h1-8,16H,9H2/b14-8-,16-15+ |
| InChIKey | NOADCYBVQGDEIV-AMVOCXCOSA-N |
| XLogP | 3.97 |
| TPSA | 54.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|