About (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane
(2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane (PubChem CID 140620743) has the molecular formula C15H25NO2S
and a molecular weight of 283.44 g/mol. Its IUPAC name is (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane.
Molecular Properties
| Compound Name | (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane |
| PubChem CID | 140620743 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane |
| SMILES | CC(C)c1ccc(S(O)(O)N2C(C)CCC2C)cc1 |
| InChI | InChI=1S/C15H25NO2S/c1-11(2)14-7-9-15(10-8-14)19(17,18)16-12(3)5-6-13(16)4/h7-13,17-18H,5-6H2,1-4H3 |
| InChIKey | RTSFJKNOJWYPJF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane?
The IUPAC name of (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane (CID 140620743) is (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane.
What is the SMILES notation for (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane?
The canonical SMILES for (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane is CC(C)c1ccc(S(O)(O)N2C(C)CCC2C)cc1.
What is the InChIKey of (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane?
The InChIKey is RTSFJKNOJWYPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2S/c1-11(2)14-7-9-15(10-8-14)19(17,18)16-12(3)5-6-13(16)4/h7-13,17-18H,5-6H2,1-4H3.
What are the key properties of (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane?
(2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane has a molecular weight of 283.44 g/mol, XLogP of 4.71, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylpyrrolidin-1-yl)-dihydroxy-(4-propan-2-ylphenyl)-λ4-sulfane is sourced from PubChem (CID 140620743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).