C30H34F2O6S2 — CID 140622348
2-[6-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]hexanoyloxy]-1,1-difluoroethanesulfonate (PubChem CID 140622348) has the molecular formula C30H34F2O6S2 and a molecular weight of 592.73 g/mol. Its IUPAC name is 2-[6-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]hexanoyloxy]-1,1-difluoroethanesulfonate.
| Compound Name | 2-[6-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]hexanoyloxy]-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 140622348 |
| Molecular Formula | C30H34F2O6S2 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 2-[6-[4-bis(4-methylphenyl)sulfonio-2,6-dimethylphenoxy]hexanoyloxy]-1,1-difluoroethanesulfonate |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2cc(C)c(OCCCCCC(=O)OCC(F)(F)S(=O)(=O)[O-])c(C)c2)cc1 |
| InChI | InChI=1S/C30H34F2O6S2/c1-21-9-13-25(14-10-21)39(26-15-11-22(2)12-16-26)27-18-23(3)29(24(4)19-27)37-17-7-5-6-8-28(33)38-20-30(31,32)40(34,35)36/h9-16,18-19H,5-8,17,20H2,1-4H3 |
| InChIKey | CTQUPSMLNGQVLZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|