C21H15NO6S2-2 — CID 140622631
[4-[8-(sulfonatomethyl)phenanthridin-6-yl]phenyl]methanesulfonate (PubChem CID 140622631) has the molecular formula C21H15NO6S2-2 and a molecular weight of 441.49 g/mol. Its IUPAC name is [4-[8-(sulfonatomethyl)phenanthridin-6-yl]phenyl]methanesulfonate.
| Compound Name | [4-[8-(sulfonatomethyl)phenanthridin-6-yl]phenyl]methanesulfonate |
|---|---|
| PubChem CID | 140622631 |
| Molecular Formula | C21H15NO6S2-2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | [4-[8-(sulfonatomethyl)phenanthridin-6-yl]phenyl]methanesulfonate |
| SMILES | O=S(=O)([O-])Cc1ccc(-c2nc3ccccc3c3ccc(CS(=O)(=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C21H17NO6S2/c23-29(24,25)12-14-5-8-16(9-6-14)21-19-11-15(13-30(26,27)28)7-10-17(19)18-3-1-2-4-20(18)22-21/h1-11H,12-13H2,(H,23,24,25)(H,26,27,28)/p-2 |
| InChIKey | XDHKJVYRZTXKKS-UHFFFAOYSA-L |
| XLogP | 3.15 |
| TPSA | 127.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|