C24H23NO4S2 — CID 126604496
3-[4-[9-(methoxysulfanylmethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfinic acid (PubChem CID 126604496) has the molecular formula C24H23NO4S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-[4-[9-(methoxysulfanylmethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfinic acid.
| Compound Name | 3-[4-[9-(methoxysulfanylmethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 126604496 |
| Molecular Formula | C24H23NO4S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 3-[4-[9-(methoxysulfanylmethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfinic acid |
| SMILES | COSCc1ccc2c(-c3ccc(OCCCS(=O)O)cc3)nc3ccccc3c2c1 |
| InChI | InChI=1S/C24H23NO4S2/c1-28-30-16-17-7-12-21-22(15-17)20-5-2-3-6-23(20)25-24(21)18-8-10-19(11-9-18)29-13-4-14-31(26)27/h2-3,5-12,15H,4,13-14,16H2,1H3,(H,26,27) |
| InChIKey | KRMDPBMXSQMBEI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|