C23H19NO7S2-2 — CID 140674494
3-[4-[9-(sulfonatomethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfonate (PubChem CID 140674494) has the molecular formula C23H19NO7S2-2 and a molecular weight of 485.54 g/mol. Its IUPAC name is 3-[4-[9-(sulfonatomethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfonate.
| Compound Name | 3-[4-[9-(sulfonatomethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 140674494 |
| Molecular Formula | C23H19NO7S2-2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 3-[4-[9-(sulfonatomethyl)phenanthridin-6-yl]phenoxy]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCOc1ccc(-c2nc3ccccc3c3cc(CS(=O)(=O)[O-])ccc23)cc1 |
| InChI | InChI=1S/C23H21NO7S2/c25-32(26,27)13-3-12-31-18-9-7-17(8-10-18)23-20-11-6-16(15-33(28,29)30)14-21(20)19-4-1-2-5-22(19)24-23/h1-2,4-11,14H,3,12-13,15H2,(H,25,26,27)(H,28,29,30)/p-2 |
| InChIKey | VAJVLCOLMVFJNE-UHFFFAOYSA-L |
| XLogP | 3.41 |
| TPSA | 136.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|