C25H41N2S+ — CID 140623808
(1Z,3E)-4-[(3E)-3-[(3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine (PubChem CID 140623808) has the molecular formula C25H41N2S+ and a molecular weight of 401.68 g/mol. Its IUPAC name is (1Z,3E)-4-[(3E)-3-[(3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-[(3E)-3-[(3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 140623808 |
| Molecular Formula | C25H41N2S+ |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | (1Z,3E)-4-[(3E)-3-[(3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine |
| SMILES | CC[NH+]1C(/C=C2/C=C(/C=C/C(C)=C\N(C)C)CC(C)(C)C2)SC2CCCCC21 |
| InChI | InChI=1S/C25H40N2S/c1-7-27-22-10-8-9-11-23(22)28-24(27)15-21-14-20(16-25(3,4)17-21)13-12-19(2)18-26(5)6/h12-15,18,22-24H,7-11,16-17H2,1-6H3/p+1/b13-12+,19-18-,21-15- |
| InChIKey | BRIHPIPAKRUILV-KDSVOXNMSA-O |
| XLogP | 4.97 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|