C25H40N2S — CID 140623809
(1Z,3E)-4-[(3E)-3-[(3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine (PubChem CID 140623809) has the molecular formula C25H40N2S and a molecular weight of 400.68 g/mol. Its IUPAC name is (1Z,3E)-4-[(3E)-3-[(3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-[(3E)-3-[(3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 140623809 |
| Molecular Formula | C25H40N2S |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | (1Z,3E)-4-[(3E)-3-[(3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazol-2-yl)methylidene]-5,5-dimethylcyclohexen-1-yl]-N,N,2-trimethylbuta-1,3-dien-1-amine |
| SMILES | CCN1C(/C=C2/C=C(/C=C/C(C)=C\N(C)C)CC(C)(C)C2)SC2CCCCC21 |
| InChI | InChI=1S/C25H40N2S/c1-7-27-22-10-8-9-11-23(22)28-24(27)15-21-14-20(16-25(3,4)17-21)13-12-19(2)18-26(5)6/h12-15,18,22-24H,7-11,16-17H2,1-6H3/b13-12+,19-18-,21-15- |
| InChIKey | BRIHPIPAKRUILV-KDSVOXNMSA-N |
| XLogP | 6.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|