C18H29NS — CID 140625831
2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazole (PubChem CID 140625831) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazole.
| Compound Name | 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 140625831 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-3a,4,5,6,7,7a-hexahydro-2H-1,3-benzothiazole |
| SMILES | CCN1C(/C=C2/C=C(C)CC(C)C2)SC2CCCCC21 |
| InChI | InChI=1S/C18H29NS/c1-4-19-16-7-5-6-8-17(16)20-18(19)12-15-10-13(2)9-14(3)11-15/h10,12,14,16-18H,4-9,11H2,1-3H3/b15-12- |
| InChIKey | WBEMZHZRIBYFFU-QINSGFPZSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |