C18H30NS+ — CID 140625830
2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium (PubChem CID 140625830) has the molecular formula C18H30NS+ and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 140625830 |
| Molecular Formula | C18H30NS+ |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazol-3-ium |
| SMILES | CC[NH+]1C(/C=C2/C=C(C)CC(C)C2)SC2CCCCC21 |
| InChI | InChI=1S/C18H29NS/c1-4-19-16-7-5-6-8-17(16)20-18(19)12-15-10-13(2)9-14(3)11-15/h10,12,14,16-18H,4-9,11H2,1-3H3/p+1/b15-12- |
| InChIKey | WBEMZHZRIBYFFU-QINSGFPZSA-O |
| XLogP | 3.58 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |