C18H31NS — CID 142009824
2-methyl-5-(4-methylcyclohexen-1-yl)-4-(4-methylcyclohexyl)-1,3-thiazolidine (PubChem CID 142009824) has the molecular formula C18H31NS and a molecular weight of 293.52 g/mol. Its IUPAC name is 2-methyl-5-(4-methylcyclohexen-1-yl)-4-(4-methylcyclohexyl)-1,3-thiazolidine.
| Compound Name | 2-methyl-5-(4-methylcyclohexen-1-yl)-4-(4-methylcyclohexyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 142009824 |
| Molecular Formula | C18H31NS |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2-methyl-5-(4-methylcyclohexen-1-yl)-4-(4-methylcyclohexyl)-1,3-thiazolidine |
| SMILES | CC1CC=C(C2SC(C)NC2C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C18H31NS/c1-12-4-8-15(9-5-12)17-18(20-14(3)19-17)16-10-6-13(2)7-11-16/h10,12-15,17-19H,4-9,11H2,1-3H3 |
| InChIKey | KTCBTOUKGOTUFT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|