C18H38N2S — CID 143703564
2,6-dimethyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]cyclohex-2-en-1-amine;ethane;propane (PubChem CID 143703564) has the molecular formula C18H38N2S and a molecular weight of 314.58 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]cyclohex-2-en-1-amine;ethane;propane.
| Compound Name | 2,6-dimethyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]cyclohex-2-en-1-amine;ethane;propane |
|---|---|
| PubChem CID | 143703564 |
| Molecular Formula | C18H38N2S |
| Molecular Weight | 314.58 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 2,6-dimethyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]cyclohex-2-en-1-amine;ethane;propane |
| SMILES | CC.CC1=CCCC(C)C1NCC1CNC(C)S1.CCC |
| InChI | InChI=1S/C13H24N2S.C3H8.C2H6/c1-9-5-4-6-10(2)13(9)15-8-12-7-14-11(3)16-12;1-3-2;1-2/h5,10-15H,4,6-8H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | FHAQCQGDROKHLY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|