C12H21NS — CID 103277778
2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-thiazolidine (PubChem CID 103277778) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-thiazolidine.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 103277778 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-thiazolidine |
| SMILES | CC1=CC(C)CC(C2NCC(C)S2)C1 |
| InChI | InChI=1S/C12H21NS/c1-8-4-9(2)6-11(5-8)12-13-7-10(3)14-12/h4,8,10-13H,5-7H2,1-3H3 |
| InChIKey | IWEIBUCFPYQCRA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|