C13H23NS — CID 103277164
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]thiolan-3-amine (PubChem CID 103277164) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]thiolan-3-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 103277164 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]thiolan-3-amine |
| SMILES | CC1=CC(C)CC(CNC2CCSC2)C1 |
| InChI | InChI=1S/C13H23NS/c1-10-5-11(2)7-12(6-10)8-14-13-3-4-15-9-13/h5,10,12-14H,3-4,6-9H2,1-2H3 |
| InChIKey | FBGFGPJLCZLBEK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|