C11H19NS — CID 103277777
2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazolidine (PubChem CID 103277777) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazolidine.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 103277777 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazolidine |
| SMILES | CC1=CC(C)CC(C2NCCS2)C1 |
| InChI | InChI=1S/C11H19NS/c1-8-5-9(2)7-10(6-8)11-12-3-4-13-11/h5,8,10-12H,3-4,6-7H2,1-2H3 |
| InChIKey | ZWFFNMMDTJYRDX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|