C18H23NS — CID 163635689
2,3,4,4a,5,5a,7b,8,9,11a,12b,12c-dodecahydro-1H-[1]benzothiolo[3,2-c]carbazole (PubChem CID 163635689) has the molecular formula C18H23NS and a molecular weight of 285.46 g/mol. Its IUPAC name is 2,3,4,4a,5,5a,7b,8,9,11a,12b,12c-dodecahydro-1H-[1]benzothiolo[3,2-c]carbazole.
| Compound Name | 2,3,4,4a,5,5a,7b,8,9,11a,12b,12c-dodecahydro-1H-[1]benzothiolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 163635689 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2,3,4,4a,5,5a,7b,8,9,11a,12b,12c-dodecahydro-1H-[1]benzothiolo[3,2-c]carbazole |
| SMILES | C1=CC2SC3=C(C=CC4NC5CCCCC5C34)C2CC1 |
| InChI | InChI=1S/C18H23NS/c1-3-7-14-13(6-1)17-15(19-14)10-9-12-11-5-2-4-8-16(11)20-18(12)17/h4,8-11,13-17,19H,1-3,5-7H2 |
| InChIKey | HZXHBNZXQFFVQP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|