C26H24N2O4S — CID 140627259
N-[4-(5,11-dioxo-1,2-dihydroindeno[1,2-c]isoquinolin-6-yl)butyl]benzenesulfonamide (PubChem CID 140627259) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is N-[4-(5,11-dioxo-1,2-dihydroindeno[1,2-c]isoquinolin-6-yl)butyl]benzenesulfonamide.
| Compound Name | N-[4-(5,11-dioxo-1,2-dihydroindeno[1,2-c]isoquinolin-6-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 140627259 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[4-(5,11-dioxo-1,2-dihydroindeno[1,2-c]isoquinolin-6-yl)butyl]benzenesulfonamide |
| SMILES | O=C1c2ccccc2-c2c1c1c(c(=O)n2CCCCNS(=O)(=O)c2ccccc2)C=CCC1 |
| InChI | InChI=1S/C26H24N2O4S/c29-25-21-14-6-5-13-20(21)24-23(25)19-12-4-7-15-22(19)26(30)28(24)17-9-8-16-27-33(31,32)18-10-2-1-3-11-18/h1-3,5-7,10-11,13-15,27H,4,8-9,12,16-17H2 |
| InChIKey | UOYMMSZLMGPACJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|