C28H22N5O3- — CID 140627907
N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-[hydroxy(oxido)amino]benzamide (PubChem CID 140627907) has the molecular formula C28H22N5O3- and a molecular weight of 476.52 g/mol. Its IUPAC name is N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-[hydroxy(oxido)amino]benzamide.
| Compound Name | N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-[hydroxy(oxido)amino]benzamide |
|---|---|
| PubChem CID | 140627907 |
| Molecular Formula | C28H22N5O3- |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[2-[(1,3-diphenylpyrazol-5-yl)amino]phenyl]-4-[hydroxy(oxido)amino]benzamide |
| SMILES | O=C(Nc1ccccc1Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C28H22N5O3/c34-28(21-15-17-23(18-16-21)33(35)36)30-25-14-8-7-13-24(25)29-27-19-26(20-9-3-1-4-10-20)31-32(27)22-11-5-2-6-12-22/h1-19,29,35H,(H,30,34)/q-1 |
| InChIKey | NIJVHMMKGPGXMF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|