C20H24N4O2 — CID 140631612
6-[(2-butan-2-yl-5-methoxyindol-1-yl)methyl]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 140631612) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 6-[(2-butan-2-yl-5-methoxyindol-1-yl)methyl]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 6-[(2-butan-2-yl-5-methoxyindol-1-yl)methyl]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 140631612 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 6-[(2-butan-2-yl-5-methoxyindol-1-yl)methyl]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | CCC(C)c1cc2cc(OC)ccc2n1Cc1cccc(C(N)=NO)n1 |
| InChI | InChI=1S/C20H24N4O2/c1-4-13(2)19-11-14-10-16(26-3)8-9-18(14)24(19)12-15-6-5-7-17(22-15)20(21)23-25/h5-11,13,25H,4,12H2,1-3H3,(H2,21,23) |
| InChIKey | OTUIKUNBMCMBLS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|