C14H21Cl2NO3 — CID 140633514
ethyl (3S)-3-amino-3-[3-chloro-5-(2-hydroxypropan-2-yl)phenyl]propanoate;hydrochloride (PubChem CID 140633514) has the molecular formula C14H21Cl2NO3 and a molecular weight of 322.23 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[3-chloro-5-(2-hydroxypropan-2-yl)phenyl]propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-[3-chloro-5-(2-hydroxypropan-2-yl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 140633514 |
| Molecular Formula | C14H21Cl2NO3 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl (3S)-3-amino-3-[3-chloro-5-(2-hydroxypropan-2-yl)phenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1cc(Cl)cc(C(C)(C)O)c1.Cl |
| InChI | InChI=1S/C14H20ClNO3.ClH/c1-4-19-13(17)8-12(16)9-5-10(14(2,3)18)7-11(15)6-9;/h5-7,12,18H,4,8,16H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | DFMHFSHMNVYFFO-YDALLXLXSA-N |
| XLogP | 2.94 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |