C8H4N4O2 — CID 140634101
8-oxa-3,4,6,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one (PubChem CID 140634101) has the molecular formula C8H4N4O2 and a molecular weight of 188.15 g/mol. Its IUPAC name is 8-oxa-3,4,6,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one.
| Compound Name | 8-oxa-3,4,6,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 140634101 |
| Molecular Formula | C8H4N4O2 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 8-oxa-3,4,6,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-7-one |
| SMILES | O=c1oc2ncccc2c2nncn12 |
| InChI | InChI=1S/C8H4N4O2/c13-8-12-4-10-11-6(12)5-2-1-3-9-7(5)14-8/h1-4H |
| InChIKey | DRUNNYQZTLEHBD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |