C20H18 — CID 140635953
1-[(3E,5E)-5-ethenylocta-1,3,5,7-tetraen-3-yl]naphthalene (PubChem CID 140635953) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-[(3E,5E)-5-ethenylocta-1,3,5,7-tetraen-3-yl]naphthalene.
| Compound Name | 1-[(3E,5E)-5-ethenylocta-1,3,5,7-tetraen-3-yl]naphthalene |
|---|---|
| PubChem CID | 140635953 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-[(3E,5E)-5-ethenylocta-1,3,5,7-tetraen-3-yl]naphthalene |
| SMILES | C=C/C=C(C=C)/C=C(\C=C)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18/c1-4-10-16(5-2)15-17(6-3)19-14-9-12-18-11-7-8-13-20(18)19/h4-15H,1-3H2/b16-10+,17-15+ |
| InChIKey | POSOVAJEEGDUMH-AMRBXKIKSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|