C11H11FN4O2 — CID 140636183
[4-(5-fluoro-3-pyridinyl)-2-methylimidazol-1-yl] N-methylcarbamate (PubChem CID 140636183) has the molecular formula C11H11FN4O2 and a molecular weight of 250.23 g/mol. Its IUPAC name is [4-(5-fluoro-3-pyridinyl)-2-methylimidazol-1-yl] N-methylcarbamate.
| Compound Name | [4-(5-fluoro-3-pyridinyl)-2-methylimidazol-1-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 140636183 |
| Molecular Formula | C11H11FN4O2 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | [4-(5-fluoro-3-pyridinyl)-2-methylimidazol-1-yl] N-methylcarbamate |
| SMILES | CNC(=O)On1cc(-c2cncc(F)c2)nc1C |
| InChI | InChI=1S/C11H11FN4O2/c1-7-15-10(6-16(7)18-11(17)13-2)8-3-9(12)5-14-4-8/h3-6H,1-2H3,(H,13,17) |
| InChIKey | JXNARUBPDKDNRM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |