C17H29F6N5O3P2 — CID 140640800
[2-[(E)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxypyrrolidin-1-yl]-dipyrrolidin-1-ylphosphanium hexafluorophosphate (PubChem CID 140640800) has the molecular formula C17H29F6N5O3P2 and a molecular weight of 527.39 g/mol. Its IUPAC name is [2-[(E)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxypyrrolidin-1-yl]-dipyrrolidin-1-ylphosphanium hexafluorophosphate.
| Compound Name | [2-[(E)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxypyrrolidin-1-yl]-dipyrrolidin-1-ylphosphanium hexafluorophosphate |
|---|---|
| PubChem CID | 140640800 |
| Molecular Formula | C17H29F6N5O3P2 |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | [2-[(E)-(1-cyano-2-ethoxy-2-oxoethylidene)amino]oxypyrrolidin-1-yl]-dipyrrolidin-1-ylphosphanium hexafluorophosphate |
| SMILES | CCOC(=O)/C(C#N)=N/OC1CCCN1[PH+](N1CCCC1)N1CCCC1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C17H28N5O3P.F6P/c1-2-24-17(23)15(14-18)19-25-16-8-7-13-22(16)26(20-9-3-4-10-20)21-11-5-6-12-21;1-7(2,3,4,5)6/h16H,2-13H2,1H3;/q;-1/p+1/b19-15+; |
| InChIKey | NRCLAPJKODXXQK-QTCZRQAZSA-O |
| XLogP | 5.40 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|